C15H13ClF3N3O3 — CID 156823232
5-[3-[5-chloro-6-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 156823232) has the molecular formula C15H13ClF3N3O3 and a molecular weight of 375.73 g/mol. Its IUPAC name is 5-[3-[5-chloro-6-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | 5-[3-[5-chloro-6-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 156823232 |
| Molecular Formula | C15H13ClF3N3O3 |
| Molecular Weight | 375.73 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 5-[3-[5-chloro-6-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CCC(=O)N2Cc3cc(Cl)c(C(F)(F)F)cc3C2)N1 |
| InChI | InChI=1S/C15H13ClF3N3O3/c16-10-4-8-6-22(5-7(8)3-9(10)15(17,18)19)12(23)2-1-11-13(24)21-14(25)20-11/h3-4,11H,1-2,5-6H2,(H2,20,21,24,25) |
| InChIKey | DHZLLKAYIFVHTI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.73 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|