C16H20N4O3 — CID 156823259
cyclopropane;5-[3-(5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 156823259) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is cyclopropane;5-[3-(5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | cyclopropane;5-[3-(5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 156823259 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | cyclopropane;5-[3-(5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | C1CC1.O=C1NC(=O)C(CCC(=O)N2Cc3cccnc3C2)N1 |
| InChI | InChI=1S/C13H14N4O3.C3H6/c18-11(4-3-9-12(19)16-13(20)15-9)17-6-8-2-1-5-14-10(8)7-17;1-2-3-1/h1-2,5,9H,3-4,6-7H2,(H2,15,16,19,20);1-3H2 |
| InChIKey | OBTASILQFIWBRW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|