About ethane;(Z)-(1-methyl-3,4-dipropylpiperidin-2-ylidene)hydrazine
ethane;(Z)-(1-methyl-3,4-dipropylpiperidin-2-ylidene)hydrazine (PubChem CID 156823597) has the molecular formula C14H31N3
and a molecular weight of 241.42 g/mol. Its IUPAC name is ethane;(Z)-(1-methyl-3,4-dipropylpiperidin-2-ylidene)hydrazine.
Molecular Properties
| Compound Name | ethane;(Z)-(1-methyl-3,4-dipropylpiperidin-2-ylidene)hydrazine |
| PubChem CID | 156823597 |
| Molecular Formula | C14H31N3 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.25 |
| IUPAC Name | ethane;(Z)-(1-methyl-3,4-dipropylpiperidin-2-ylidene)hydrazine |
| SMILES | CC.CCCC1CCN(C)/C(=N\N)C1CCC |
| InChI | InChI=1S/C12H25N3.C2H6/c1-4-6-10-8-9-15(3)12(14-13)11(10)7-5-2;1-2/h10-11H,4-9,13H2,1-3H3;1-2H3/b14-12-; |
| InChIKey | CJXCISACPMZISZ-CTMPBGLUSA-N |
| XLogP | 3.45 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-(1-methyl-3,4-dipropylpiperidin-2-ylidene)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-(1-methyl-3,4-dipropylpiperidin-2-ylidene)hydrazine?
The IUPAC name of ethane;(Z)-(1-methyl-3,4-dipropylpiperidin-2-ylidene)hydrazine (CID 156823597) is ethane;(Z)-(1-methyl-3,4-dipropylpiperidin-2-ylidene)hydrazine.
What is the SMILES notation for ethane;(Z)-(1-methyl-3,4-dipropylpiperidin-2-ylidene)hydrazine?
The canonical SMILES for ethane;(Z)-(1-methyl-3,4-dipropylpiperidin-2-ylidene)hydrazine is CC.CCCC1CCN(C)/C(=N\N)C1CCC.
What is the InChIKey of ethane;(Z)-(1-methyl-3,4-dipropylpiperidin-2-ylidene)hydrazine?
The InChIKey is CJXCISACPMZISZ-CTMPBGLUSA-N. The full InChI is InChI=1S/C12H25N3.C2H6/c1-4-6-10-8-9-15(3)12(14-13)11(10)7-5-2;1-2/h10-11H,4-9,13H2,1-3H3;1-2H3/b14-12-;.
What are the key properties of ethane;(Z)-(1-methyl-3,4-dipropylpiperidin-2-ylidene)hydrazine?
ethane;(Z)-(1-methyl-3,4-dipropylpiperidin-2-ylidene)hydrazine has a molecular weight of 241.42 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-(1-methyl-3,4-dipropylpiperidin-2-ylidene)hydrazine is sourced from PubChem (CID 156823597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).