C17H24N2O2 — CID 156824587
1-[2-[(1E,4E,6Z)-5-methoxycycloocta-1,4,6-trien-1-yl]ethyl]-3-[(3E)-penta-1,3-dien-3-yl]urea (PubChem CID 156824587) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-[2-[(1E,4E,6Z)-5-methoxycycloocta-1,4,6-trien-1-yl]ethyl]-3-[(3E)-penta-1,3-dien-3-yl]urea.
| Compound Name | 1-[2-[(1E,4E,6Z)-5-methoxycycloocta-1,4,6-trien-1-yl]ethyl]-3-[(3E)-penta-1,3-dien-3-yl]urea |
|---|---|
| PubChem CID | 156824587 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-[2-[(1E,4E,6Z)-5-methoxycycloocta-1,4,6-trien-1-yl]ethyl]-3-[(3E)-penta-1,3-dien-3-yl]urea |
| SMILES | C=C/C(=C\C)NC(=O)NCC/C1=C/C/C=C(OC)\C=C/C1 |
| InChI | InChI=1S/C17H24N2O2/c1-4-15(5-2)19-17(20)18-13-12-14-8-6-10-16(21-3)11-7-9-14/h4-6,9-11H,1,7-8,12-13H2,2-3H3,(H2,18,19,20)/b10-6-,14-9+,15-5+,16-11+ |
| InChIKey | NUTXITUYUNQPHN-CZGSXKBUSA-N |
| XLogP | 3.57 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|