C9H11NO2S — CID 156825235
4-(1,1-dioxothietan-3-yl)aniline (PubChem CID 156825235) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is 4-(1,1-dioxothietan-3-yl)aniline.
| Compound Name | 4-(1,1-dioxothietan-3-yl)aniline |
|---|---|
| PubChem CID | 156825235 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 4-(1,1-dioxothietan-3-yl)aniline |
| SMILES | Nc1ccc(C2CS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C9H11NO2S/c10-9-3-1-7(2-4-9)8-5-13(11,12)6-8/h1-4,8H,5-6,10H2 |
| InChIKey | NJLJZSOTOHVSGJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|