About 3-cyclopropyloxy-2,5-difluorobenzonitrile
3-cyclopropyloxy-2,5-difluorobenzonitrile (PubChem CID 156825517) has the molecular formula C10H7F2NO
and a molecular weight of 195.17 g/mol. Its IUPAC name is 3-cyclopropyloxy-2,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 3-cyclopropyloxy-2,5-difluorobenzonitrile |
| PubChem CID | 156825517 |
| Molecular Formula | C10H7F2NO |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 3-cyclopropyloxy-2,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)cc(OC2CC2)c1F |
| InChI | InChI=1S/C10H7F2NO/c11-7-3-6(5-13)10(12)9(4-7)14-8-1-2-8/h3-4,8H,1-2H2 |
| InChIKey | AMPMVZUXAKSPRK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopropyloxy-2,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyloxy-2,5-difluorobenzonitrile?
The IUPAC name of 3-cyclopropyloxy-2,5-difluorobenzonitrile (CID 156825517) is 3-cyclopropyloxy-2,5-difluorobenzonitrile.
What is the SMILES notation for 3-cyclopropyloxy-2,5-difluorobenzonitrile?
The canonical SMILES for 3-cyclopropyloxy-2,5-difluorobenzonitrile is N#Cc1cc(F)cc(OC2CC2)c1F.
What is the InChIKey of 3-cyclopropyloxy-2,5-difluorobenzonitrile?
The InChIKey is AMPMVZUXAKSPRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F2NO/c11-7-3-6(5-13)10(12)9(4-7)14-8-1-2-8/h3-4,8H,1-2H2.
What are the key properties of 3-cyclopropyloxy-2,5-difluorobenzonitrile?
3-cyclopropyloxy-2,5-difluorobenzonitrile has a molecular weight of 195.17 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyloxy-2,5-difluorobenzonitrile is sourced from PubChem (CID 156825517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).