C23H18F4N6O — CID 156825541
3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-6-[1-[2-fluoro-5-(trifluoromethyl)phenyl]ethyl]-7,8-dihydro-1,6-naphthyridin-5-one (PubChem CID 156825541) has the molecular formula C23H18F4N6O and a molecular weight of 470.43 g/mol. Its IUPAC name is 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-6-[1-[2-fluoro-5-(trifluoromethyl)phenyl]ethyl]-7,8-dihydro-1,6-naphthyridin-5-one.
| Compound Name | 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-6-[1-[2-fluoro-5-(trifluoromethyl)phenyl]ethyl]-7,8-dihydro-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 156825541 |
| Molecular Formula | C23H18F4N6O |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 3-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-6-[1-[2-fluoro-5-(trifluoromethyl)phenyl]ethyl]-7,8-dihydro-1,6-naphthyridin-5-one |
| SMILES | CC(c1cc(C(F)(F)F)ccc1F)N1CCc2ncc(-c3ccn4nc(N)nc4c3)cc2C1=O |
| InChI | InChI=1S/C23H18F4N6O/c1-12(16-10-15(23(25,26)27)2-3-18(16)24)32-6-5-19-17(21(32)34)8-14(11-29-19)13-4-7-33-20(9-13)30-22(28)31-33/h2-4,7-12H,5-6H2,1H3,(H2,28,31) |
| InChIKey | GFWYHQLKLCEIBV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |