About [2-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]methanol
[2-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]methanol (PubChem CID 156825854) has the molecular formula C11H11BrF2N2O
and a molecular weight of 305.12 g/mol. Its IUPAC name is [2-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [2-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]methanol |
| PubChem CID | 156825854 |
| Molecular Formula | C11H11BrF2N2O |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | [2-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]methanol |
| SMILES | OCc1ccc(N2CC3C(C2)C3(F)F)nc1Br |
| InChI | InChI=1S/C11H11BrF2N2O/c12-10-6(5-17)1-2-9(15-10)16-3-7-8(4-16)11(7,13)14/h1-2,7-8,17H,3-5H2 |
| InChIKey | IVZYMFZPHDTABL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [2-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]methanol?
The IUPAC name of [2-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]methanol (CID 156825854) is [2-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]methanol.
What is the SMILES notation for [2-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]methanol?
The canonical SMILES for [2-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]methanol is OCc1ccc(N2CC3C(C2)C3(F)F)nc1Br.
What is the InChIKey of [2-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]methanol?
The InChIKey is IVZYMFZPHDTABL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrF2N2O/c12-10-6(5-17)1-2-9(15-10)16-3-7-8(4-16)11(7,13)14/h1-2,7-8,17H,3-5H2.
What are the key properties of [2-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]methanol?
[2-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]methanol has a molecular weight of 305.12 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)-3-pyridinyl]methanol is sourced from PubChem (CID 156825854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).