About 1-[[5-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]methyl]pyrazole-4-carboxylic acid
1-[[5-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]methyl]pyrazole-4-carboxylic acid (PubChem CID 156825934) has the molecular formula C15H14F2N4O2
and a molecular weight of 320.30 g/mol. Its IUPAC name is 1-[[5-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]methyl]pyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[5-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]methyl]pyrazole-4-carboxylic acid |
| PubChem CID | 156825934 |
| Molecular Formula | C15H14F2N4O2 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 1-[[5-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]methyl]pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(Cc2ccc(N3CC4[C@H](C3)C4(F)F)cn2)c1 |
| InChI | InChI=1S/C15H14F2N4O2/c16-15(17)12-7-20(8-13(12)15)11-2-1-10(18-4-11)6-21-5-9(3-19-21)14(22)23/h1-5,12-13H,6-8H2,(H,22,23)/t12-,13?/m0/s1 |
| InChIKey | ZFOZPZSTKWFUEK-UEWDXFNNSA-N |
| XLogP | 1.73 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[5-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]methyl]pyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]methyl]pyrazole-4-carboxylic acid?
The IUPAC name of 1-[[5-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]methyl]pyrazole-4-carboxylic acid (CID 156825934) is 1-[[5-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]methyl]pyrazole-4-carboxylic acid.
What is the SMILES notation for 1-[[5-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]methyl]pyrazole-4-carboxylic acid?
The canonical SMILES for 1-[[5-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]methyl]pyrazole-4-carboxylic acid is O=C(O)c1cnn(Cc2ccc(N3CC4[C@H](C3)C4(F)F)cn2)c1.
What is the InChIKey of 1-[[5-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]methyl]pyrazole-4-carboxylic acid?
The InChIKey is ZFOZPZSTKWFUEK-UEWDXFNNSA-N. The full InChI is InChI=1S/C15H14F2N4O2/c16-15(17)12-7-20(8-13(12)15)11-2-1-10(18-4-11)6-21-5-9(3-19-21)14(22)23/h1-5,12-13H,6-8H2,(H,22,23)/t12-,13?/m0/s1.
What are the key properties of 1-[[5-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]methyl]pyrazole-4-carboxylic acid?
1-[[5-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]methyl]pyrazole-4-carboxylic acid has a molecular weight of 320.30 g/mol, XLogP of 1.73, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-[(5R)-6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]methyl]pyrazole-4-carboxylic acid is sourced from PubChem (CID 156825934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).