About 2-bromo-4-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)benzaldehyde
2-bromo-4-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)benzaldehyde (PubChem CID 156826342) has the molecular formula C12H10BrF2NO
and a molecular weight of 302.12 g/mol. Its IUPAC name is 2-bromo-4-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)benzaldehyde.
Molecular Properties
| Compound Name | 2-bromo-4-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)benzaldehyde |
| PubChem CID | 156826342 |
| Molecular Formula | C12H10BrF2NO |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 2-bromo-4-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)benzaldehyde |
| SMILES | O=Cc1ccc(N2CC3C(C2)C3(F)F)cc1Br |
| InChI | InChI=1S/C12H10BrF2NO/c13-11-3-8(2-1-7(11)6-17)16-4-9-10(5-16)12(9,14)15/h1-3,6,9-10H,4-5H2 |
| InChIKey | JMIYTVZJQAXIQK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)benzaldehyde?
The IUPAC name of 2-bromo-4-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)benzaldehyde (CID 156826342) is 2-bromo-4-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)benzaldehyde.
What is the SMILES notation for 2-bromo-4-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)benzaldehyde?
The canonical SMILES for 2-bromo-4-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)benzaldehyde is O=Cc1ccc(N2CC3C(C2)C3(F)F)cc1Br.
What is the InChIKey of 2-bromo-4-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)benzaldehyde?
The InChIKey is JMIYTVZJQAXIQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrF2NO/c13-11-3-8(2-1-7(11)6-17)16-4-9-10(5-16)12(9,14)15/h1-3,6,9-10H,4-5H2.
What are the key properties of 2-bromo-4-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)benzaldehyde?
2-bromo-4-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)benzaldehyde has a molecular weight of 302.12 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)benzaldehyde is sourced from PubChem (CID 156826342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).