C14H16FN3O3 — CID 156826413
ethyl 3-[(6-fluoro-2-methyl-3-pyridinyl)-hydroxymethyl]-1-methylpyrazole-5-carboxylate (PubChem CID 156826413) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is ethyl 3-[(6-fluoro-2-methyl-3-pyridinyl)-hydroxymethyl]-1-methylpyrazole-5-carboxylate.
| Compound Name | ethyl 3-[(6-fluoro-2-methyl-3-pyridinyl)-hydroxymethyl]-1-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 156826413 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | ethyl 3-[(6-fluoro-2-methyl-3-pyridinyl)-hydroxymethyl]-1-methylpyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(C(O)c2ccc(F)nc2C)nn1C |
| InChI | InChI=1S/C14H16FN3O3/c1-4-21-14(20)11-7-10(17-18(11)3)13(19)9-5-6-12(15)16-8(9)2/h5-7,13,19H,4H2,1-3H3 |
| InChIKey | MGPOYXSNZSARBK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|