About (Z)-1-[amino(2,4-dimethylpentan-2-yl)amino]prop-1-en-2-amine;ethane
(Z)-1-[amino(2,4-dimethylpentan-2-yl)amino]prop-1-en-2-amine;ethane (PubChem CID 156826830) has the molecular formula C12H29N3
and a molecular weight of 215.38 g/mol. Its IUPAC name is (Z)-1-[amino(2,4-dimethylpentan-2-yl)amino]prop-1-en-2-amine;ethane.
Molecular Properties
| Compound Name | (Z)-1-[amino(2,4-dimethylpentan-2-yl)amino]prop-1-en-2-amine;ethane |
| PubChem CID | 156826830 |
| Molecular Formula | C12H29N3 |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.24 |
| IUPAC Name | (Z)-1-[amino(2,4-dimethylpentan-2-yl)amino]prop-1-en-2-amine;ethane |
| SMILES | C/C(N)=C/N(N)C(C)(C)CC(C)C.CC |
| InChI | InChI=1S/C10H23N3.C2H6/c1-8(2)6-10(4,5)13(12)7-9(3)11;1-2/h7-8H,6,11-12H2,1-5H3;1-2H3/b9-7-; |
| InChIKey | RWGWWOKELVAWRI-VILQZVERSA-N |
| XLogP | 2.83 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-[amino(2,4-dimethylpentan-2-yl)amino]prop-1-en-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-[amino(2,4-dimethylpentan-2-yl)amino]prop-1-en-2-amine;ethane?
The IUPAC name of (Z)-1-[amino(2,4-dimethylpentan-2-yl)amino]prop-1-en-2-amine;ethane (CID 156826830) is (Z)-1-[amino(2,4-dimethylpentan-2-yl)amino]prop-1-en-2-amine;ethane.
What is the SMILES notation for (Z)-1-[amino(2,4-dimethylpentan-2-yl)amino]prop-1-en-2-amine;ethane?
The canonical SMILES for (Z)-1-[amino(2,4-dimethylpentan-2-yl)amino]prop-1-en-2-amine;ethane is C/C(N)=C/N(N)C(C)(C)CC(C)C.CC.
What is the InChIKey of (Z)-1-[amino(2,4-dimethylpentan-2-yl)amino]prop-1-en-2-amine;ethane?
The InChIKey is RWGWWOKELVAWRI-VILQZVERSA-N. The full InChI is InChI=1S/C10H23N3.C2H6/c1-8(2)6-10(4,5)13(12)7-9(3)11;1-2/h7-8H,6,11-12H2,1-5H3;1-2H3/b9-7-;.
What are the key properties of (Z)-1-[amino(2,4-dimethylpentan-2-yl)amino]prop-1-en-2-amine;ethane?
(Z)-1-[amino(2,4-dimethylpentan-2-yl)amino]prop-1-en-2-amine;ethane has a molecular weight of 215.38 g/mol, XLogP of 2.83, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-[amino(2,4-dimethylpentan-2-yl)amino]prop-1-en-2-amine;ethane is sourced from PubChem (CID 156826830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).