C22H23F2N3O — CID 156827794
4-[3-[(4-aminocyclohexyl)methyl]-7-methylimidazo[1,2-a]pyridin-2-yl]-3,5-difluorobenzaldehyde (PubChem CID 156827794) has the molecular formula C22H23F2N3O and a molecular weight of 383.44 g/mol. Its IUPAC name is 4-[3-[(4-aminocyclohexyl)methyl]-7-methylimidazo[1,2-a]pyridin-2-yl]-3,5-difluorobenzaldehyde.
| Compound Name | 4-[3-[(4-aminocyclohexyl)methyl]-7-methylimidazo[1,2-a]pyridin-2-yl]-3,5-difluorobenzaldehyde |
|---|---|
| PubChem CID | 156827794 |
| Molecular Formula | C22H23F2N3O |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 4-[3-[(4-aminocyclohexyl)methyl]-7-methylimidazo[1,2-a]pyridin-2-yl]-3,5-difluorobenzaldehyde |
| SMILES | Cc1ccn2c(CC3CCC(N)CC3)c(-c3c(F)cc(C=O)cc3F)nc2c1 |
| InChI | InChI=1S/C22H23F2N3O/c1-13-6-7-27-19(11-14-2-4-16(25)5-3-14)22(26-20(27)8-13)21-17(23)9-15(12-28)10-18(21)24/h6-10,12,14,16H,2-5,11,25H2,1H3 |
| InChIKey | LRPXABRGIZGFML-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|