About US12473304, Example 322
US12473304, Example 322 (PubChem CID 156829809) has the molecular formula C32H31FN8O
and a molecular weight of 562.60 g/mol. Its IUPAC name is [(3R,5R)-3-amino-5-fluoropiperidin-1-yl]-[2-[1-(cyclopropylmethyl)-6-(1H-indazol-4-yl)pyrrolo[2,3-b]pyridin-2-yl]-3-methylpyrazolo[1,5-a]pyridin-6-yl]methanone.
Molecular Properties
| Compound Name | US12473304, Example 322 |
| PubChem CID | 156829809 |
| Molecular Formula | C32H31FN8O |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | [(3R,5R)-3-amino-5-fluoropiperidin-1-yl]-[2-[1-(cyclopropylmethyl)-6-(1H-indazol-4-yl)pyrrolo[2,3-b]pyridin-2-yl]-3-methylpyrazolo[1,5-a]pyridin-6-yl]methanone |
| SMILES | CC1=C2C=CC(=CN2N=C1C3=CC4=C(N3CC5CC5)N=C(C=C4)C6=C7C=NNC7=CC=C6)C(=O)N8C[C@@H](C[C@H](C8)F)N |
| InChI | InChI=1S/C32H31FN8O/c1-18-28-10-8-21(32(42)39-16-22(33)12-23(34)17-39)15-41(28)38-30(18)29-11-20-7-9-26(36-31(20)40(29)14-19-5-6-19)24-3-2-4-27-25(24)13-35-37-27/h2-4,7-11,13,15,19,22-23H,5-6,12,14,16-17,34H2,1H3,(H,35,37)/t22-,23-/m1/s1 |
| InChIKey | ZPKBUSMWNOANCW-DHIUTWEWSA-N |
| XLogP | 3.60 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | 1000 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze US12473304, Example 322 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US12473304, Example 322?
The IUPAC name of US12473304, Example 322 (CID 156829809) is [(3R,5R)-3-amino-5-fluoropiperidin-1-yl]-[2-[1-(cyclopropylmethyl)-6-(1H-indazol-4-yl)pyrrolo[2,3-b]pyridin-2-yl]-3-methylpyrazolo[1,5-a]pyridin-6-yl]methanone.
What is the SMILES notation for US12473304, Example 322?
The canonical SMILES for US12473304, Example 322 is CC1=C2C=CC(=CN2N=C1C3=CC4=C(N3CC5CC5)N=C(C=C4)C6=C7C=NNC7=CC=C6)C(=O)N8C[C@@H](C[C@H](C8)F)N.
What is the InChIKey of US12473304, Example 322?
The InChIKey is ZPKBUSMWNOANCW-DHIUTWEWSA-N. The full InChI is InChI=1S/C32H31FN8O/c1-18-28-10-8-21(32(42)39-16-22(33)12-23(34)17-39)15-41(28)38-30(18)29-11-20-7-9-26(36-31(20)40(29)14-19-5-6-19)24-3-2-4-27-25(24)13-35-37-27/h2-4,7-11,13,15,19,22-23H,5-6,12,14,16-17,34H2,1H3,(H,35,37)/t22-,23-/m1/s1.
What are the key properties of US12473304, Example 322?
US12473304, Example 322 has a molecular weight of 562.60 g/mol, XLogP of 3.60, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for US12473304, Example 322 is sourced from PubChem (CID 156829809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).