C12H13ClN4 — CID 156830628
(1R)-N-[(5-chloro-2-pyridinyl)methyl]-1-pyrimidin-2-ylethanamine (PubChem CID 156830628) has the molecular formula C12H13ClN4 and a molecular weight of 248.72 g/mol. Its IUPAC name is (1R)-N-[(5-chloro-2-pyridinyl)methyl]-1-pyrimidin-2-ylethanamine.
| Compound Name | (1R)-N-[(5-chloro-2-pyridinyl)methyl]-1-pyrimidin-2-ylethanamine |
|---|---|
| PubChem CID | 156830628 |
| Molecular Formula | C12H13ClN4 |
| Molecular Weight | 248.72 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (1R)-N-[(5-chloro-2-pyridinyl)methyl]-1-pyrimidin-2-ylethanamine |
| SMILES | C[C@@H](NCc1ccc(Cl)cn1)c1ncccn1 |
| InChI | InChI=1S/C12H13ClN4/c1-9(12-14-5-2-6-15-12)16-8-11-4-3-10(13)7-17-11/h2-7,9,16H,8H2,1H3/t9-/m1/s1 |
| InChIKey | KKOUFAYOGOWMHV-SECBINFHSA-N |
| XLogP | 2.38 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.72 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |