C19H17ClFNO3S2 — CID 156831158
S-ethyl (2S)-1-(4-chlorophenyl)sulfonyl-2-(4-fluorophenyl)-2,5-dihydropyrrole-3-carbothioate (PubChem CID 156831158) has the molecular formula C19H17ClFNO3S2 and a molecular weight of 425.93 g/mol. Its IUPAC name is S-ethyl (2S)-1-(4-chlorophenyl)sulfonyl-2-(4-fluorophenyl)-2,5-dihydropyrrole-3-carbothioate.
| Compound Name | S-ethyl (2S)-1-(4-chlorophenyl)sulfonyl-2-(4-fluorophenyl)-2,5-dihydropyrrole-3-carbothioate |
|---|---|
| PubChem CID | 156831158 |
| Molecular Formula | C19H17ClFNO3S2 |
| Molecular Weight | 425.93 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | S-ethyl (2S)-1-(4-chlorophenyl)sulfonyl-2-(4-fluorophenyl)-2,5-dihydropyrrole-3-carbothioate |
| SMILES | CCSC(=O)C1=CCN(S(=O)(=O)c2ccc(Cl)cc2)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17ClFNO3S2/c1-2-26-19(23)17-11-12-22(18(17)13-3-7-15(21)8-4-13)27(24,25)16-9-5-14(20)6-10-16/h3-11,18H,2,12H2,1H3/t18-/m0/s1 |
| InChIKey | WRRBGYHJFVYQAS-SFHVURJKSA-N |
| XLogP | 4.43 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.93 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|