C18H22N2O4S — CID 156831318
ethyl 2-methyl-1,1-dioxo-6-pent-4-ynyl-3-phenyl-3H-1,2,6-thiadiazine-4-carboxylate (PubChem CID 156831318) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is ethyl 2-methyl-1,1-dioxo-6-pent-4-ynyl-3-phenyl-3H-1,2,6-thiadiazine-4-carboxylate.
| Compound Name | ethyl 2-methyl-1,1-dioxo-6-pent-4-ynyl-3-phenyl-3H-1,2,6-thiadiazine-4-carboxylate |
|---|---|
| PubChem CID | 156831318 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | ethyl 2-methyl-1,1-dioxo-6-pent-4-ynyl-3-phenyl-3H-1,2,6-thiadiazine-4-carboxylate |
| SMILES | C#CCCCN1C=C(C(=O)OCC)C(c2ccccc2)N(C)S1(=O)=O |
| InChI | InChI=1S/C18H22N2O4S/c1-4-6-10-13-20-14-16(18(21)24-5-2)17(19(3)25(20,22)23)15-11-8-7-9-12-15/h1,7-9,11-12,14,17H,5-6,10,13H2,2-3H3 |
| InChIKey | KTYYNCJPFONSSW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|