C25H29N5O — CID 156831882
(3aR,6aR)-4-[6-[3-(3-methylphenyl)pyrazol-1-yl]-2-pent-4-enylpyrimidin-4-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole (PubChem CID 156831882) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is (3aR,6aR)-4-[6-[3-(3-methylphenyl)pyrazol-1-yl]-2-pent-4-enylpyrimidin-4-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole.
| Compound Name | (3aR,6aR)-4-[6-[3-(3-methylphenyl)pyrazol-1-yl]-2-pent-4-enylpyrimidin-4-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole |
|---|---|
| PubChem CID | 156831882 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | (3aR,6aR)-4-[6-[3-(3-methylphenyl)pyrazol-1-yl]-2-pent-4-enylpyrimidin-4-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole |
| SMILES | C=CCCCc1nc(N2CC[C@H]3OCC[C@H]32)cc(-n2ccc(-c3cccc(C)c3)n2)n1 |
| InChI | InChI=1S/C25H29N5O/c1-3-4-5-9-23-26-24(29-13-11-22-21(29)12-15-31-22)17-25(27-23)30-14-10-20(28-30)19-8-6-7-18(2)16-19/h3,6-8,10,14,16-17,21-22H,1,4-5,9,11-13,15H2,2H3/t21-,22-/m1/s1 |
| InChIKey | TZSKSWCEDMOWAN-FGZHOGPDSA-N |
| XLogP | 4.51 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|