C21H18N4O2 — CID 156834081
3-[1-[4-(2,5-dimethoxyphenyl)phenyl]triazol-4-yl]pyridine (PubChem CID 156834081) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-[1-[4-(2,5-dimethoxyphenyl)phenyl]triazol-4-yl]pyridine.
| Compound Name | 3-[1-[4-(2,5-dimethoxyphenyl)phenyl]triazol-4-yl]pyridine |
|---|---|
| PubChem CID | 156834081 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 3-[1-[4-(2,5-dimethoxyphenyl)phenyl]triazol-4-yl]pyridine |
| SMILES | COc1ccc(OC)c(-c2ccc(-n3cc(-c4cccnc4)nn3)cc2)c1 |
| InChI | InChI=1S/C21H18N4O2/c1-26-18-9-10-21(27-2)19(12-18)15-5-7-17(8-6-15)25-14-20(23-24-25)16-4-3-11-22-13-16/h3-14H,1-2H3 |
| InChIKey | JUOOKMXPMCKVAM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |