About methyl 4-[4-[4-(2,5-dimethoxyphenyl)phenyl]triazol-1-yl]pyridine-2-carboxylate
methyl 4-[4-[4-(2,5-dimethoxyphenyl)phenyl]triazol-1-yl]pyridine-2-carboxylate (PubChem CID 156834092) has the molecular formula C23H20N4O4
and a molecular weight of 416.44 g/mol. Its IUPAC name is methyl 4-[4-[4-(2,5-dimethoxyphenyl)phenyl]triazol-1-yl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[4-[4-(2,5-dimethoxyphenyl)phenyl]triazol-1-yl]pyridine-2-carboxylate |
| PubChem CID | 156834092 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | methyl 4-[4-[4-(2,5-dimethoxyphenyl)phenyl]triazol-1-yl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(-n2cc(-c3ccc(-c4cc(OC)ccc4OC)cc3)nn2)ccn1 |
| InChI | InChI=1S/C23H20N4O4/c1-29-18-8-9-22(30-2)19(13-18)15-4-6-16(7-5-15)21-14-27(26-25-21)17-10-11-24-20(12-17)23(28)31-3/h4-14H,1-3H3 |
| InChIKey | LJMOYLLJOFPLDB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 4-[4-[4-(2,5-dimethoxyphenyl)phenyl]triazol-1-yl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[4-[4-(2,5-dimethoxyphenyl)phenyl]triazol-1-yl]pyridine-2-carboxylate?
The IUPAC name of methyl 4-[4-[4-(2,5-dimethoxyphenyl)phenyl]triazol-1-yl]pyridine-2-carboxylate (CID 156834092) is methyl 4-[4-[4-(2,5-dimethoxyphenyl)phenyl]triazol-1-yl]pyridine-2-carboxylate.
What is the SMILES notation for methyl 4-[4-[4-(2,5-dimethoxyphenyl)phenyl]triazol-1-yl]pyridine-2-carboxylate?
The canonical SMILES for methyl 4-[4-[4-(2,5-dimethoxyphenyl)phenyl]triazol-1-yl]pyridine-2-carboxylate is COC(=O)c1cc(-n2cc(-c3ccc(-c4cc(OC)ccc4OC)cc3)nn2)ccn1.
What is the InChIKey of methyl 4-[4-[4-(2,5-dimethoxyphenyl)phenyl]triazol-1-yl]pyridine-2-carboxylate?
The InChIKey is LJMOYLLJOFPLDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O4/c1-29-18-8-9-22(30-2)19(13-18)15-4-6-16(7-5-15)21-14-27(26-25-21)17-10-11-24-20(12-17)23(28)31-3/h4-14H,1-3H3.
What are the key properties of methyl 4-[4-[4-(2,5-dimethoxyphenyl)phenyl]triazol-1-yl]pyridine-2-carboxylate?
methyl 4-[4-[4-(2,5-dimethoxyphenyl)phenyl]triazol-1-yl]pyridine-2-carboxylate has a molecular weight of 416.44 g/mol, XLogP of 3.80, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-[4-(2,5-dimethoxyphenyl)phenyl]triazol-1-yl]pyridine-2-carboxylate is sourced from PubChem (CID 156834092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).