C14H24N4O2 — CID 156834820
N-ethoxy-N-[1-[(1-methylimidazol-2-yl)methyl]piperidin-3-yl]acetamide (PubChem CID 156834820) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-ethoxy-N-[1-[(1-methylimidazol-2-yl)methyl]piperidin-3-yl]acetamide.
| Compound Name | N-ethoxy-N-[1-[(1-methylimidazol-2-yl)methyl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 156834820 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N-ethoxy-N-[1-[(1-methylimidazol-2-yl)methyl]piperidin-3-yl]acetamide |
| SMILES | CCON(C(C)=O)C1CCCN(Cc2nccn2C)C1 |
| InChI | InChI=1S/C14H24N4O2/c1-4-20-18(12(2)19)13-6-5-8-17(10-13)11-14-15-7-9-16(14)3/h7,9,13H,4-6,8,10-11H2,1-3H3 |
| InChIKey | VFAVRWVRCZTONW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|