About 5-methylhex-5-ene-2,4-dione
5-methylhex-5-ene-2,4-dione (PubChem CID 15683512) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is 5-methylhex-5-ene-2,4-dione.
Molecular Properties
| Compound Name | 5-methylhex-5-ene-2,4-dione |
| PubChem CID | 15683512 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 5-methylhex-5-ene-2,4-dione |
| SMILES | C=C(C)C(=O)CC(C)=O |
| InChI | InChI=1S/C7H10O2/c1-5(2)7(9)4-6(3)8/h1,4H2,2-3H3 |
| InChIKey | RKAZWPVRTYSEED-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhex-5-ene-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhex-5-ene-2,4-dione?
The IUPAC name of 5-methylhex-5-ene-2,4-dione (CID 15683512) is 5-methylhex-5-ene-2,4-dione.
What is the SMILES notation for 5-methylhex-5-ene-2,4-dione?
The canonical SMILES for 5-methylhex-5-ene-2,4-dione is C=C(C)C(=O)CC(C)=O.
What is the InChIKey of 5-methylhex-5-ene-2,4-dione?
The InChIKey is RKAZWPVRTYSEED-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-5(2)7(9)4-6(3)8/h1,4H2,2-3H3.
What are the key properties of 5-methylhex-5-ene-2,4-dione?
5-methylhex-5-ene-2,4-dione has a molecular weight of 126.15 g/mol, XLogP of 1.11, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhex-5-ene-2,4-dione is sourced from PubChem (CID 15683512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).