About [4-(trifluoromethyl)cyclohexyl] (2R)-2-aminopropanoate
[4-(trifluoromethyl)cyclohexyl] (2R)-2-aminopropanoate (PubChem CID 156835419) has the molecular formula C10H16F3NO2
and a molecular weight of 239.24 g/mol. Its IUPAC name is [4-(trifluoromethyl)cyclohexyl] (2R)-2-aminopropanoate.
Molecular Properties
| Compound Name | [4-(trifluoromethyl)cyclohexyl] (2R)-2-aminopropanoate |
| PubChem CID | 156835419 |
| Molecular Formula | C10H16F3NO2 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | [4-(trifluoromethyl)cyclohexyl] (2R)-2-aminopropanoate |
| SMILES | C[C@@H](N)C(=O)OC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H16F3NO2/c1-6(14)9(15)16-8-4-2-7(3-5-8)10(11,12)13/h6-8H,2-5,14H2,1H3/t6-,7?,8?/m1/s1 |
| InChIKey | DWSWYVRVZAGIST-JECWYVHBSA-N |
| XLogP | 2.00 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(trifluoromethyl)cyclohexyl] (2R)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(trifluoromethyl)cyclohexyl] (2R)-2-aminopropanoate?
The IUPAC name of [4-(trifluoromethyl)cyclohexyl] (2R)-2-aminopropanoate (CID 156835419) is [4-(trifluoromethyl)cyclohexyl] (2R)-2-aminopropanoate.
What is the SMILES notation for [4-(trifluoromethyl)cyclohexyl] (2R)-2-aminopropanoate?
The canonical SMILES for [4-(trifluoromethyl)cyclohexyl] (2R)-2-aminopropanoate is C[C@@H](N)C(=O)OC1CCC(C(F)(F)F)CC1.
What is the InChIKey of [4-(trifluoromethyl)cyclohexyl] (2R)-2-aminopropanoate?
The InChIKey is DWSWYVRVZAGIST-JECWYVHBSA-N. The full InChI is InChI=1S/C10H16F3NO2/c1-6(14)9(15)16-8-4-2-7(3-5-8)10(11,12)13/h6-8H,2-5,14H2,1H3/t6-,7?,8?/m1/s1.
What are the key properties of [4-(trifluoromethyl)cyclohexyl] (2R)-2-aminopropanoate?
[4-(trifluoromethyl)cyclohexyl] (2R)-2-aminopropanoate has a molecular weight of 239.24 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(trifluoromethyl)cyclohexyl] (2R)-2-aminopropanoate is sourced from PubChem (CID 156835419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).