C28H32F3N6O8P — CID 156835479
[4-(trifluoromethyl)cyclohexyl] (2R)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 156835479) has the molecular formula C28H32F3N6O8P and a molecular weight of 668.57 g/mol. Its IUPAC name is [4-(trifluoromethyl)cyclohexyl] (2R)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | [4-(trifluoromethyl)cyclohexyl] (2R)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156835479 |
| Molecular Formula | C28H32F3N6O8P |
| Molecular Weight | 668.57 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | [4-(trifluoromethyl)cyclohexyl] (2R)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@@H](NP(=O)(OC[C@@]1(C#N)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C28H32F3N6O8P/c1-16(26(40)43-18-9-7-17(8-10-18)28(29,30)31)36-46(41,45-19-5-3-2-4-6-19)42-14-27(13-32)24(39)22(38)23(44-27)20-11-12-21-25(33)34-15-35-37(20)21/h2-6,11-12,15-18,22-24,38-39H,7-10,14H2,1H3,(H,36,41)(H2,33,34,35)/t16-,17?,18?,22+,23+,24+,27-,46?/m1/s1 |
| InChIKey | GMCCBPQILRTPEV-PMVMBUEASA-N |
| XLogP | 3.21 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|