C7H3ClN3O2Y- — CID 156836325
7-chloro-1,6-dihydropyrido[2,3-d]pyrimidin-6-ide-2,4-dione;yttrium (PubChem CID 156836325) has the molecular formula C7H3ClN3O2Y- and a molecular weight of 285.48 g/mol. Its IUPAC name is 7-chloro-1,6-dihydropyrido[2,3-d]pyrimidin-6-ide-2,4-dione;yttrium.
| Compound Name | 7-chloro-1,6-dihydropyrido[2,3-d]pyrimidin-6-ide-2,4-dione;yttrium |
|---|---|
| PubChem CID | 156836325 |
| Molecular Formula | C7H3ClN3O2Y- |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 284.90 |
| IUPAC Name | 7-chloro-1,6-dihydropyrido[2,3-d]pyrimidin-6-ide-2,4-dione;yttrium |
| SMILES | O=c1[nH]c(=O)c2c[c-]c(Cl)nc2[nH]1.[Y] |
| InChI | InChI=1S/C7H3ClN3O2.Y/c8-4-2-1-3-5(9-4)10-7(13)11-6(3)12;/h1H,(H2,9,10,11,12,13);/q-1; |
| InChIKey | JIBOQXSUVOFOMN-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|