About 6-methyl-1,6-diazabicyclo[3.2.1]octan-7-one
6-methyl-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 156836548) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 6-methyl-1,6-diazabicyclo[3.2.1]octan-7-one.
Molecular Properties
| Compound Name | 6-methyl-1,6-diazabicyclo[3.2.1]octan-7-one |
| PubChem CID | 156836548 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 6-methyl-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | CN1C(=O)N2CCCC1C2 |
| InChI | InChI=1S/C7H12N2O/c1-8-6-3-2-4-9(5-6)7(8)10/h6H,2-5H2,1H3 |
| InChIKey | CPSPKHXYPHNJLZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methyl-1,6-diazabicyclo[3.2.1]octan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,6-diazabicyclo[3.2.1]octan-7-one?
The IUPAC name of 6-methyl-1,6-diazabicyclo[3.2.1]octan-7-one (CID 156836548) is 6-methyl-1,6-diazabicyclo[3.2.1]octan-7-one.
What is the SMILES notation for 6-methyl-1,6-diazabicyclo[3.2.1]octan-7-one?
The canonical SMILES for 6-methyl-1,6-diazabicyclo[3.2.1]octan-7-one is CN1C(=O)N2CCCC1C2.
What is the InChIKey of 6-methyl-1,6-diazabicyclo[3.2.1]octan-7-one?
The InChIKey is CPSPKHXYPHNJLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-8-6-3-2-4-9(5-6)7(8)10/h6H,2-5H2,1H3.
What are the key properties of 6-methyl-1,6-diazabicyclo[3.2.1]octan-7-one?
6-methyl-1,6-diazabicyclo[3.2.1]octan-7-one has a molecular weight of 140.19 g/mol, XLogP of 0.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,6-diazabicyclo[3.2.1]octan-7-one is sourced from PubChem (CID 156836548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).