About ethane;molecular hydrogen;4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylic acid
ethane;molecular hydrogen;4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylic acid (PubChem CID 156836664) has the molecular formula C19H37N3O3
and a molecular weight of 355.52 g/mol. Its IUPAC name is ethane;molecular hydrogen;4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylic acid.
Molecular Properties
| Compound Name | ethane;molecular hydrogen;4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylic acid |
| PubChem CID | 156836664 |
| Molecular Formula | C19H37N3O3 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.28 |
| IUPAC Name | ethane;molecular hydrogen;4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylic acid |
| SMILES | CC.CC(C)C12CCC(NC(=O)N3CCN(C(=O)O)CC3)(CC1)CC2.[H][H] |
| InChI | InChI=1S/C17H29N3O3.C2H6.H2/c1-13(2)16-3-6-17(7-4-16,8-5-16)18-14(21)19-9-11-20(12-10-19)15(22)23;1-2;/h13H,3-12H2,1-2H3,(H,18,21)(H,22,23);1-2H3;1H |
| InChIKey | MWODRYLTLMYXNP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;molecular hydrogen;4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;molecular hydrogen;4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylic acid?
The IUPAC name of ethane;molecular hydrogen;4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylic acid (CID 156836664) is ethane;molecular hydrogen;4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylic acid.
What is the SMILES notation for ethane;molecular hydrogen;4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylic acid?
The canonical SMILES for ethane;molecular hydrogen;4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylic acid is CC.CC(C)C12CCC(NC(=O)N3CCN(C(=O)O)CC3)(CC1)CC2.[H][H].
What is the InChIKey of ethane;molecular hydrogen;4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylic acid?
The InChIKey is MWODRYLTLMYXNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N3O3.C2H6.H2/c1-13(2)16-3-6-17(7-4-16,8-5-16)18-14(21)19-9-11-20(12-10-19)15(22)23;1-2;/h13H,3-12H2,1-2H3,(H,18,21)(H,22,23);1-2H3;1H.
What are the key properties of ethane;molecular hydrogen;4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylic acid?
ethane;molecular hydrogen;4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylic acid has a molecular weight of 355.52 g/mol, XLogP of 4.01, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;molecular hydrogen;4-[(4-propan-2-yl-1-bicyclo[2.2.2]octanyl)carbamoyl]piperazine-1-carboxylic acid is sourced from PubChem (CID 156836664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).