C22H46N4O — CID 156836987
ethane;2-(4-methylpiperazin-1-yl)-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]ethanone (PubChem CID 156836987) has the molecular formula C22H46N4O and a molecular weight of 382.64 g/mol. Its IUPAC name is ethane;2-(4-methylpiperazin-1-yl)-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]ethanone.
| Compound Name | ethane;2-(4-methylpiperazin-1-yl)-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 156836987 |
| Molecular Formula | C22H46N4O |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 382.37 |
| IUPAC Name | ethane;2-(4-methylpiperazin-1-yl)-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]ethanone |
| SMILES | CC.CC.CN1CCC(C2CCN(C(=O)CN3CCN(C)CC3)CC2)CC1 |
| InChI | InChI=1S/C18H34N4O.2C2H6/c1-19-7-3-16(4-8-19)17-5-9-22(10-6-17)18(23)15-21-13-11-20(2)12-14-21;2*1-2/h16-17H,3-15H2,1-2H3;2*1-2H3 |
| InChIKey | POZBZUIPRLZLSY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |