C13H21BrClN3 — CID 156837357
(2Z,4Z)-4-[(Z)-2-amino-1-chloroethenyl]-8-methyl-9-(methylamino)nona-2,4-dienimidoyl bromide (PubChem CID 156837357) has the molecular formula C13H21BrClN3 and a molecular weight of 334.69 g/mol. Its IUPAC name is (2Z,4Z)-4-[(Z)-2-amino-1-chloroethenyl]-8-methyl-9-(methylamino)nona-2,4-dienimidoyl bromide.
| Compound Name | (2Z,4Z)-4-[(Z)-2-amino-1-chloroethenyl]-8-methyl-9-(methylamino)nona-2,4-dienimidoyl bromide |
|---|---|
| PubChem CID | 156837357 |
| Molecular Formula | C13H21BrClN3 |
| Molecular Weight | 334.69 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | (2Z,4Z)-4-[(Z)-2-amino-1-chloroethenyl]-8-methyl-9-(methylamino)nona-2,4-dienimidoyl bromide |
| SMILES | [H]/N=C(Br)/C=C\C(=C\CCC(C)CNC)\C(Cl)=C\N |
| InChI | InChI=1S/C13H21BrClN3/c1-10(9-18-2)4-3-5-11(12(15)8-16)6-7-13(14)17/h5-8,10,17-18H,3-4,9,16H2,1-2H3/b7-6-,11-5-,12-8-,17-13- |
| InChIKey | CYDFXLIZKTXNBN-ZKPFPIFSSA-N |
| XLogP | 3.52 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.69 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|