About 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-pyrrol-5-ol
2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-pyrrol-5-ol (PubChem CID 156837370) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-pyrrol-5-ol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-pyrrol-5-ol |
| PubChem CID | 156837370 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-pyrrol-5-ol |
| SMILES | CC1=C(O)NC(CO)C1 |
| InChI | InChI=1S/C6H11NO2/c1-4-2-5(3-8)7-6(4)9/h5,7-9H,2-3H2,1H3 |
| InChIKey | JFZHSWQGUBNPRN-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-pyrrol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-pyrrol-5-ol?
The IUPAC name of 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-pyrrol-5-ol (CID 156837370) is 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-pyrrol-5-ol.
What is the SMILES notation for 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-pyrrol-5-ol?
The canonical SMILES for 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-pyrrol-5-ol is CC1=C(O)NC(CO)C1.
What is the InChIKey of 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-pyrrol-5-ol?
The InChIKey is JFZHSWQGUBNPRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c1-4-2-5(3-8)7-6(4)9/h5,7-9H,2-3H2,1H3.
What are the key properties of 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-pyrrol-5-ol?
2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-pyrrol-5-ol has a molecular weight of 129.16 g/mol, XLogP of 0.13, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-4-methyl-2,3-dihydro-1H-pyrrol-5-ol is sourced from PubChem (CID 156837370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).