C22H24F3N5O2 — CID 156837800
N-[(3R,4S)-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3,4-dihydro-2H-chromen-4-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 156837800) has the molecular formula C22H24F3N5O2 and a molecular weight of 447.46 g/mol. Its IUPAC name is N-[(3R,4S)-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3,4-dihydro-2H-chromen-4-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(3R,4S)-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3,4-dihydro-2H-chromen-4-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 156837800 |
| Molecular Formula | C22H24F3N5O2 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-[(3R,4S)-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3,4-dihydro-2H-chromen-4-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C[C@@H]1CN([C@H]2COc3ccccc3[C@@H]2Nc2ncnc3[nH]c(C(F)(F)F)cc23)C[C@H](C)O1 |
| InChI | InChI=1S/C22H24F3N5O2/c1-12-8-30(9-13(2)32-12)16-10-31-17-6-4-3-5-14(17)19(16)29-21-15-7-18(22(23,24)25)28-20(15)26-11-27-21/h3-7,11-13,16,19H,8-10H2,1-2H3,(H2,26,27,28,29)/t12-,13+,16-,19-/m0/s1 |
| InChIKey | SCQIQSNBTQSBHR-AODNKKSCSA-N |
| XLogP | 4.00 |
| TPSA | 75.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |