C14H28N4O2 — CID 156838374
1,4,10,13-tetrazacyclooctadecane-7,16-dione (PubChem CID 156838374) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 1,4,10,13-tetrazacyclooctadecane-7,16-dione.
| Compound Name | 1,4,10,13-tetrazacyclooctadecane-7,16-dione |
|---|---|
| PubChem CID | 156838374 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | 1,4,10,13-tetrazacyclooctadecane-7,16-dione |
| SMILES | O=C1CCNCCNCCC(=O)CCNCCNCC1 |
| InChI | InChI=1S/C14H28N4O2/c19-13-1-5-15-9-10-17-7-3-14(20)4-8-18-12-11-16-6-2-13/h15-18H,1-12H2 |
| InChIKey | AOQAWFLOJFQJED-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |