About ethane;5-ethyl-5-methyl-4,6-dihydro-3H-pyridazine
ethane;5-ethyl-5-methyl-4,6-dihydro-3H-pyridazine (PubChem CID 156838752) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is ethane;5-ethyl-5-methyl-4,6-dihydro-3H-pyridazine.
Molecular Properties
| Compound Name | ethane;5-ethyl-5-methyl-4,6-dihydro-3H-pyridazine |
| PubChem CID | 156838752 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | ethane;5-ethyl-5-methyl-4,6-dihydro-3H-pyridazine |
| SMILES | CC.CCC1(C)CCN=NC1 |
| InChI | InChI=1S/C7H14N2.C2H6/c1-3-7(2)4-5-8-9-6-7;1-2/h3-6H2,1-2H3;1-2H3 |
| InChIKey | BBWZHVLXILMZNF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;5-ethyl-5-methyl-4,6-dihydro-3H-pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethyl-5-methyl-4,6-dihydro-3H-pyridazine?
The IUPAC name of ethane;5-ethyl-5-methyl-4,6-dihydro-3H-pyridazine (CID 156838752) is ethane;5-ethyl-5-methyl-4,6-dihydro-3H-pyridazine.
What is the SMILES notation for ethane;5-ethyl-5-methyl-4,6-dihydro-3H-pyridazine?
The canonical SMILES for ethane;5-ethyl-5-methyl-4,6-dihydro-3H-pyridazine is CC.CCC1(C)CCN=NC1.
What is the InChIKey of ethane;5-ethyl-5-methyl-4,6-dihydro-3H-pyridazine?
The InChIKey is BBWZHVLXILMZNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.C2H6/c1-3-7(2)4-5-8-9-6-7;1-2/h3-6H2,1-2H3;1-2H3.
What are the key properties of ethane;5-ethyl-5-methyl-4,6-dihydro-3H-pyridazine?
ethane;5-ethyl-5-methyl-4,6-dihydro-3H-pyridazine has a molecular weight of 156.27 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethyl-5-methyl-4,6-dihydro-3H-pyridazine is sourced from PubChem (CID 156838752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).