About tert-butyl (3S,4R)-3-(isoquinolin-5-ylcarbamothioyloxy)-4-phenylpyrrolidine-1-carboxylate
tert-butyl (3S,4R)-3-(isoquinolin-5-ylcarbamothioyloxy)-4-phenylpyrrolidine-1-carboxylate (PubChem CID 156839396) has the molecular formula C25H27N3O3S
and a molecular weight of 449.58 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-(isoquinolin-5-ylcarbamothioyloxy)-4-phenylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3S,4R)-3-(isoquinolin-5-ylcarbamothioyloxy)-4-phenylpyrrolidine-1-carboxylate |
| PubChem CID | 156839396 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | tert-butyl (3S,4R)-3-(isoquinolin-5-ylcarbamothioyloxy)-4-phenylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](OC(=S)Nc2cccc3cnccc23)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C25H27N3O3S/c1-25(2,3)31-24(29)28-15-20(17-8-5-4-6-9-17)22(16-28)30-23(32)27-21-11-7-10-18-14-26-13-12-19(18)21/h4-14,20,22H,15-16H2,1-3H3,(H,27,32)/t20-,22+/m0/s1 |
| InChIKey | NLNITGAYAAZULQ-RBBKRZOGSA-N |
| XLogP | 5.35 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (3S,4R)-3-(isoquinolin-5-ylcarbamothioyloxy)-4-phenylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S,4R)-3-(isoquinolin-5-ylcarbamothioyloxy)-4-phenylpyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (3S,4R)-3-(isoquinolin-5-ylcarbamothioyloxy)-4-phenylpyrrolidine-1-carboxylate (CID 156839396) is tert-butyl (3S,4R)-3-(isoquinolin-5-ylcarbamothioyloxy)-4-phenylpyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3S,4R)-3-(isoquinolin-5-ylcarbamothioyloxy)-4-phenylpyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (3S,4R)-3-(isoquinolin-5-ylcarbamothioyloxy)-4-phenylpyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1C[C@@H](OC(=S)Nc2cccc3cnccc23)[C@H](c2ccccc2)C1.
What is the InChIKey of tert-butyl (3S,4R)-3-(isoquinolin-5-ylcarbamothioyloxy)-4-phenylpyrrolidine-1-carboxylate?
The InChIKey is NLNITGAYAAZULQ-RBBKRZOGSA-N. The full InChI is InChI=1S/C25H27N3O3S/c1-25(2,3)31-24(29)28-15-20(17-8-5-4-6-9-17)22(16-28)30-23(32)27-21-11-7-10-18-14-26-13-12-19(18)21/h4-14,20,22H,15-16H2,1-3H3,(H,27,32)/t20-,22+/m0/s1.
What are the key properties of tert-butyl (3S,4R)-3-(isoquinolin-5-ylcarbamothioyloxy)-4-phenylpyrrolidine-1-carboxylate?
tert-butyl (3S,4R)-3-(isoquinolin-5-ylcarbamothioyloxy)-4-phenylpyrrolidine-1-carboxylate has a molecular weight of 449.58 g/mol, XLogP of 5.35, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S,4R)-3-(isoquinolin-5-ylcarbamothioyloxy)-4-phenylpyrrolidine-1-carboxylate is sourced from PubChem (CID 156839396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).