About 4,6-dibromo-5-hydroxy-1,2-dimethylindole-3-carbonitrile
4,6-dibromo-5-hydroxy-1,2-dimethylindole-3-carbonitrile (PubChem CID 15683954) has the molecular formula C11H8Br2N2O
and a molecular weight of 344.01 g/mol. Its IUPAC name is 4,6-dibromo-5-hydroxy-1,2-dimethylindole-3-carbonitrile.
Molecular Properties
| Compound Name | 4,6-dibromo-5-hydroxy-1,2-dimethylindole-3-carbonitrile |
| PubChem CID | 15683954 |
| Molecular Formula | C11H8Br2N2O |
| Molecular Weight | 344.01 g/mol |
| Exact Mass | 341.90 |
| IUPAC Name | 4,6-dibromo-5-hydroxy-1,2-dimethylindole-3-carbonitrile |
| SMILES | Cc1c(C#N)c2c(Br)c(O)c(Br)cc2n1C |
| InChI | InChI=1S/C11H8Br2N2O/c1-5-6(4-14)9-8(15(5)2)3-7(12)11(16)10(9)13/h3,16H,1-2H3 |
| InChIKey | GKNDFDCONMHIPD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.01 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-dibromo-5-hydroxy-1,2-dimethylindole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dibromo-5-hydroxy-1,2-dimethylindole-3-carbonitrile?
The IUPAC name of 4,6-dibromo-5-hydroxy-1,2-dimethylindole-3-carbonitrile (CID 15683954) is 4,6-dibromo-5-hydroxy-1,2-dimethylindole-3-carbonitrile.
What is the SMILES notation for 4,6-dibromo-5-hydroxy-1,2-dimethylindole-3-carbonitrile?
The canonical SMILES for 4,6-dibromo-5-hydroxy-1,2-dimethylindole-3-carbonitrile is Cc1c(C#N)c2c(Br)c(O)c(Br)cc2n1C.
What is the InChIKey of 4,6-dibromo-5-hydroxy-1,2-dimethylindole-3-carbonitrile?
The InChIKey is GKNDFDCONMHIPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Br2N2O/c1-5-6(4-14)9-8(15(5)2)3-7(12)11(16)10(9)13/h3,16H,1-2H3.
What are the key properties of 4,6-dibromo-5-hydroxy-1,2-dimethylindole-3-carbonitrile?
4,6-dibromo-5-hydroxy-1,2-dimethylindole-3-carbonitrile has a molecular weight of 344.01 g/mol, XLogP of 3.59, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dibromo-5-hydroxy-1,2-dimethylindole-3-carbonitrile is sourced from PubChem (CID 15683954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).