C25H25IN2O4S — CID 15684002
(E)-6-[3-[2-[(4-iodophenyl)sulfonylamino]ethyl]phenyl]-6-pyridin-3-ylhex-5-enoic acid (PubChem CID 15684002) has the molecular formula C25H25IN2O4S and a molecular weight of 576.46 g/mol. Its IUPAC name is (E)-6-[3-[2-[(4-iodophenyl)sulfonylamino]ethyl]phenyl]-6-pyridin-3-ylhex-5-enoic acid.
| Compound Name | (E)-6-[3-[2-[(4-iodophenyl)sulfonylamino]ethyl]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
|---|---|
| PubChem CID | 15684002 |
| Molecular Formula | C25H25IN2O4S |
| Molecular Weight | 576.46 g/mol |
| Exact Mass | 576.06 |
| IUPAC Name | (E)-6-[3-[2-[(4-iodophenyl)sulfonylamino]ethyl]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
| SMILES | O=C(O)CCC/C=C(/c1cccnc1)c1cccc(CCNS(=O)(=O)c2ccc(I)cc2)c1 |
| InChI | InChI=1S/C25H25IN2O4S/c26-22-10-12-23(13-11-22)33(31,32)28-16-14-19-5-3-6-20(17-19)24(8-1-2-9-25(29)30)21-7-4-15-27-18-21/h3-8,10-13,15,17-18,28H,1-2,9,14,16H2,(H,29,30)/b24-8+ |
| InChIKey | PJZSRUKFPMOTFE-KTZMUZOWSA-N |
| XLogP | 4.89 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|