About 5-methylpyrido[4,3-a]indolizine-10-carbonitrile
5-methylpyrido[4,3-a]indolizine-10-carbonitrile (PubChem CID 15684073) has the molecular formula C13H9N3
and a molecular weight of 207.24 g/mol. Its IUPAC name is 5-methylpyrido[4,3-a]indolizine-10-carbonitrile.
Molecular Properties
| Compound Name | 5-methylpyrido[4,3-a]indolizine-10-carbonitrile |
| PubChem CID | 15684073 |
| Molecular Formula | C13H9N3 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 5-methylpyrido[4,3-a]indolizine-10-carbonitrile |
| SMILES | Cc1cccn2c(C#N)c3cnccc3c12 |
| InChI | InChI=1S/C13H9N3/c1-9-3-2-6-16-12(7-14)11-8-15-5-4-10(11)13(9)16/h2-6,8H,1H3 |
| InChIKey | WURKEGHNXAVRTP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methylpyrido[4,3-a]indolizine-10-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylpyrido[4,3-a]indolizine-10-carbonitrile?
The IUPAC name of 5-methylpyrido[4,3-a]indolizine-10-carbonitrile (CID 15684073) is 5-methylpyrido[4,3-a]indolizine-10-carbonitrile.
What is the SMILES notation for 5-methylpyrido[4,3-a]indolizine-10-carbonitrile?
The canonical SMILES for 5-methylpyrido[4,3-a]indolizine-10-carbonitrile is Cc1cccn2c(C#N)c3cnccc3c12.
What is the InChIKey of 5-methylpyrido[4,3-a]indolizine-10-carbonitrile?
The InChIKey is WURKEGHNXAVRTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3/c1-9-3-2-6-16-12(7-14)11-8-15-5-4-10(11)13(9)16/h2-6,8H,1H3.
What are the key properties of 5-methylpyrido[4,3-a]indolizine-10-carbonitrile?
5-methylpyrido[4,3-a]indolizine-10-carbonitrile has a molecular weight of 207.24 g/mol, XLogP of 2.67, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylpyrido[4,3-a]indolizine-10-carbonitrile is sourced from PubChem (CID 15684073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).