About 3-ethyl-1-methyl-4,5-dihydro-3H-pyrido[3,4-b]azepin-2-one
3-ethyl-1-methyl-4,5-dihydro-3H-pyrido[3,4-b]azepin-2-one (PubChem CID 156842913) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-ethyl-1-methyl-4,5-dihydro-3H-pyrido[3,4-b]azepin-2-one.
Molecular Properties
| Compound Name | 3-ethyl-1-methyl-4,5-dihydro-3H-pyrido[3,4-b]azepin-2-one |
| PubChem CID | 156842913 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-ethyl-1-methyl-4,5-dihydro-3H-pyrido[3,4-b]azepin-2-one |
| SMILES | CCC1CCc2ccncc2N(C)C1=O |
| InChI | InChI=1S/C12H16N2O/c1-3-9-4-5-10-6-7-13-8-11(10)14(2)12(9)15/h6-9H,3-5H2,1-2H3 |
| InChIKey | QILGQQGYOAOJCF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1-methyl-4,5-dihydro-3H-pyrido[3,4-b]azepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-methyl-4,5-dihydro-3H-pyrido[3,4-b]azepin-2-one?
The IUPAC name of 3-ethyl-1-methyl-4,5-dihydro-3H-pyrido[3,4-b]azepin-2-one (CID 156842913) is 3-ethyl-1-methyl-4,5-dihydro-3H-pyrido[3,4-b]azepin-2-one.
What is the SMILES notation for 3-ethyl-1-methyl-4,5-dihydro-3H-pyrido[3,4-b]azepin-2-one?
The canonical SMILES for 3-ethyl-1-methyl-4,5-dihydro-3H-pyrido[3,4-b]azepin-2-one is CCC1CCc2ccncc2N(C)C1=O.
What is the InChIKey of 3-ethyl-1-methyl-4,5-dihydro-3H-pyrido[3,4-b]azepin-2-one?
The InChIKey is QILGQQGYOAOJCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-3-9-4-5-10-6-7-13-8-11(10)14(2)12(9)15/h6-9H,3-5H2,1-2H3.
What are the key properties of 3-ethyl-1-methyl-4,5-dihydro-3H-pyrido[3,4-b]azepin-2-one?
3-ethyl-1-methyl-4,5-dihydro-3H-pyrido[3,4-b]azepin-2-one has a molecular weight of 204.27 g/mol, XLogP of 2.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-methyl-4,5-dihydro-3H-pyrido[3,4-b]azepin-2-one is sourced from PubChem (CID 156842913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).