About ethane;5-methyl-7-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-2,3-dihydro-1,5-benzoxazepin-4-one
ethane;5-methyl-7-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 156843103) has the molecular formula C19H28N2O3
and a molecular weight of 332.44 g/mol. Its IUPAC name is ethane;5-methyl-7-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-2,3-dihydro-1,5-benzoxazepin-4-one.
Molecular Properties
| Compound Name | ethane;5-methyl-7-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-2,3-dihydro-1,5-benzoxazepin-4-one |
| PubChem CID | 156843103 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | ethane;5-methyl-7-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | CC.CN1C(=O)CCOc2ccc(N3CC4(CCOCC4)C3)cc21 |
| InChI | InChI=1S/C17H22N2O3.C2H6/c1-18-14-10-13(2-3-15(14)22-7-4-16(18)20)19-11-17(12-19)5-8-21-9-6-17;1-2/h2-3,10H,4-9,11-12H2,1H3;1-2H3 |
| InChIKey | WPJUISCLOOOPBA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-methyl-7-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-2,3-dihydro-1,5-benzoxazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-7-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-2,3-dihydro-1,5-benzoxazepin-4-one?
The IUPAC name of ethane;5-methyl-7-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-2,3-dihydro-1,5-benzoxazepin-4-one (CID 156843103) is ethane;5-methyl-7-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-2,3-dihydro-1,5-benzoxazepin-4-one.
What is the SMILES notation for ethane;5-methyl-7-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-2,3-dihydro-1,5-benzoxazepin-4-one?
The canonical SMILES for ethane;5-methyl-7-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-2,3-dihydro-1,5-benzoxazepin-4-one is CC.CN1C(=O)CCOc2ccc(N3CC4(CCOCC4)C3)cc21.
What is the InChIKey of ethane;5-methyl-7-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-2,3-dihydro-1,5-benzoxazepin-4-one?
The InChIKey is WPJUISCLOOOPBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O3.C2H6/c1-18-14-10-13(2-3-15(14)22-7-4-16(18)20)19-11-17(12-19)5-8-21-9-6-17;1-2/h2-3,10H,4-9,11-12H2,1H3;1-2H3.
What are the key properties of ethane;5-methyl-7-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-2,3-dihydro-1,5-benzoxazepin-4-one?
ethane;5-methyl-7-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-2,3-dihydro-1,5-benzoxazepin-4-one has a molecular weight of 332.44 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-7-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-2,3-dihydro-1,5-benzoxazepin-4-one is sourced from PubChem (CID 156843103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).