C14H12ClF3N4OZn — CID 156843221
zinc 1-[(3S)-4-(2-chloro-5,6-dimethanidylpyrimidin-4-yl)-3-ethynylpiperazin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 156843221) has the molecular formula C14H12ClF3N4OZn and a molecular weight of 410.11 g/mol. Its IUPAC name is zinc 1-[(3S)-4-(2-chloro-5,6-dimethanidylpyrimidin-4-yl)-3-ethynylpiperazin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | zinc 1-[(3S)-4-(2-chloro-5,6-dimethanidylpyrimidin-4-yl)-3-ethynylpiperazin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 156843221 |
| Molecular Formula | C14H12ClF3N4OZn |
| Molecular Weight | 410.11 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | zinc 1-[(3S)-4-(2-chloro-5,6-dimethanidylpyrimidin-4-yl)-3-ethynylpiperazin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | C#C[C@H]1CN(C(=O)C(F)(F)F)CCN1c1nc(Cl)nc([CH2-])c1[CH2-].[Zn+2] |
| InChI | InChI=1S/C14H12ClF3N4O.Zn/c1-4-10-7-21(12(23)14(16,17)18)5-6-22(10)11-8(2)9(3)19-13(15)20-11;/h1,10H,2-3,5-7H2;/q-2;+2/t10-;/m0./s1 |
| InChIKey | BJVRMIAKXCWFMF-PPHPATTJSA-N |
| XLogP | 1.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.11 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|