C14H14ClF3N4O — CID 156843222
1-[(3S)-4-(2-chloro-5,6-dimethylpyrimidin-4-yl)-3-ethynylpiperazin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 156843222) has the molecular formula C14H14ClF3N4O and a molecular weight of 346.74 g/mol. Its IUPAC name is 1-[(3S)-4-(2-chloro-5,6-dimethylpyrimidin-4-yl)-3-ethynylpiperazin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(3S)-4-(2-chloro-5,6-dimethylpyrimidin-4-yl)-3-ethynylpiperazin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 156843222 |
| Molecular Formula | C14H14ClF3N4O |
| Molecular Weight | 346.74 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 1-[(3S)-4-(2-chloro-5,6-dimethylpyrimidin-4-yl)-3-ethynylpiperazin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | C#C[C@H]1CN(C(=O)C(F)(F)F)CCN1c1nc(Cl)nc(C)c1C |
| InChI | InChI=1S/C14H14ClF3N4O/c1-4-10-7-21(12(23)14(16,17)18)5-6-22(10)11-8(2)9(3)19-13(15)20-11/h1,10H,5-7H2,2-3H3/t10-/m0/s1 |
| InChIKey | AMDDMBHXPQSVRL-JTQLQIEISA-N |
| XLogP | 1.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.74 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|