C30H40N8O2 — CID 156843386
1-[(2R,5S)-2,5-dimethyl-4-[6-[(5-methyl-1H-indazol-4-yl)methyl]-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 156843386) has the molecular formula C30H40N8O2 and a molecular weight of 544.70 g/mol. Its IUPAC name is 1-[(2R,5S)-2,5-dimethyl-4-[6-[(5-methyl-1H-indazol-4-yl)methyl]-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R,5S)-2,5-dimethyl-4-[6-[(5-methyl-1H-indazol-4-yl)methyl]-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156843386 |
| Molecular Formula | C30H40N8O2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | 1-[(2R,5S)-2,5-dimethyl-4-[6-[(5-methyl-1H-indazol-4-yl)methyl]-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](C)N(c2nc(OC[C@@H]3CCCN3C)nc3c2CN(Cc2c(C)ccc4[nH]ncc24)C3)C[C@H]1C |
| InChI | InChI=1S/C30H40N8O2/c1-6-28(39)37-13-21(4)38(14-20(37)3)29-25-16-36(15-24-19(2)9-10-26-23(24)12-31-34-26)17-27(25)32-30(33-29)40-18-22-8-7-11-35(22)5/h6,9-10,12,20-22H,1,7-8,11,13-18H2,2-5H3,(H,31,34)/t20-,21+,22+/m1/s1 |
| InChIKey | YPOJTNGRKCCDCG-FSSWDIPSSA-N |
| XLogP | 3.26 |
| TPSA | 93.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|