C29H36N6O3 — CID 156843727
1-[5-[6-(2,3-dihydro-1H-inden-1-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]-7-hydroxy-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one (PubChem CID 156843727) has the molecular formula C29H36N6O3 and a molecular weight of 516.65 g/mol. Its IUPAC name is 1-[5-[6-(2,3-dihydro-1H-inden-1-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]-7-hydroxy-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[5-[6-(2,3-dihydro-1H-inden-1-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]-7-hydroxy-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156843727 |
| Molecular Formula | C29H36N6O3 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 1-[5-[6-(2,3-dihydro-1H-inden-1-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]-7-hydroxy-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2C(O)C1CN2c1nc(OC[C@@H]2CCCN2C)nc2c1CN(C1CCc3ccccc31)C2 |
| InChI | InChI=1S/C29H36N6O3/c1-3-26(36)34-15-25-27(37)24(34)16-35(25)28-21-13-33(23-11-10-18-7-4-5-9-20(18)23)14-22(21)30-29(31-28)38-17-19-8-6-12-32(19)2/h3-5,7,9,19,23-25,27,37H,1,6,8,10-17H2,2H3/t19-,23?,24?,25?,27?/m0/s1 |
| InChIKey | TXXWEQSMRMZMIU-PQAYHMODSA-N |
| XLogP | 1.90 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|