About ethane;ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone
ethane;ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone (PubChem CID 156843736) has the molecular formula C10H21F3N2O2
and a molecular weight of 258.28 g/mol. Its IUPAC name is ethane;ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone.
Molecular Properties
| Compound Name | ethane;ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone |
| PubChem CID | 156843736 |
| Molecular Formula | C10H21F3N2O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | ethane;ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone |
| SMILES | CC.CCO.O=C(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C6H9F3N2O.C2H6O.C2H6/c7-6(8,9)5(12)11-3-1-10-2-4-11;1-2-3;1-2/h10H,1-4H2;3H,2H2,1H3;1-2H3 |
| InChIKey | MUKFYVOGWRGLNW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone?
The IUPAC name of ethane;ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone (CID 156843736) is ethane;ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone.
What is the SMILES notation for ethane;ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone?
The canonical SMILES for ethane;ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone is CC.CCO.O=C(N1CCNCC1)C(F)(F)F.
What is the InChIKey of ethane;ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone?
The InChIKey is MUKFYVOGWRGLNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F3N2O.C2H6O.C2H6/c7-6(8,9)5(12)11-3-1-10-2-4-11;1-2-3;1-2/h10H,1-4H2;3H,2H2,1H3;1-2H3.
What are the key properties of ethane;ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone?
ethane;ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone has a molecular weight of 258.28 g/mol, XLogP of 1.01, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethanol;2,2,2-trifluoro-1-piperazin-1-ylethanone is sourced from PubChem (CID 156843736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).