C12H16F3N — CID 156843885
N-[(2E,4Z)-2-[(Z)-prop-1-enyl]-4-(trifluoromethyl)hepta-2,4-dienyl]methanimine (PubChem CID 156843885) has the molecular formula C12H16F3N and a molecular weight of 231.26 g/mol. Its IUPAC name is N-[(2E,4Z)-2-[(Z)-prop-1-enyl]-4-(trifluoromethyl)hepta-2,4-dienyl]methanimine.
| Compound Name | N-[(2E,4Z)-2-[(Z)-prop-1-enyl]-4-(trifluoromethyl)hepta-2,4-dienyl]methanimine |
|---|---|
| PubChem CID | 156843885 |
| Molecular Formula | C12H16F3N |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | N-[(2E,4Z)-2-[(Z)-prop-1-enyl]-4-(trifluoromethyl)hepta-2,4-dienyl]methanimine |
| SMILES | C=NCC(/C=C\C)=C/C(=C/CC)C(F)(F)F |
| InChI | InChI=1S/C12H16F3N/c1-4-6-10(9-16-3)8-11(7-5-2)12(13,14)15/h4,6-8H,3,5,9H2,1-2H3/b6-4-,10-8+,11-7- |
| InChIKey | BYGHYNRUKKILCG-ZYIGCRMGSA-N |
| XLogP | 4.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|