C26H33F3N2O2 — CID 156843961
methyl N-[(5E,7Z)-3-methyl-5-[(Z)-prop-1-enyl]-7-(trifluoromethyl)deca-3,5,7-trien-4-yl]-2-[(2-phenylacetyl)amino]ethanimidate (PubChem CID 156843961) has the molecular formula C26H33F3N2O2 and a molecular weight of 462.56 g/mol. Its IUPAC name is methyl N-[(5E,7Z)-3-methyl-5-[(Z)-prop-1-enyl]-7-(trifluoromethyl)deca-3,5,7-trien-4-yl]-2-[(2-phenylacetyl)amino]ethanimidate.
| Compound Name | methyl N-[(5E,7Z)-3-methyl-5-[(Z)-prop-1-enyl]-7-(trifluoromethyl)deca-3,5,7-trien-4-yl]-2-[(2-phenylacetyl)amino]ethanimidate |
|---|---|
| PubChem CID | 156843961 |
| Molecular Formula | C26H33F3N2O2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | methyl N-[(5E,7Z)-3-methyl-5-[(Z)-prop-1-enyl]-7-(trifluoromethyl)deca-3,5,7-trien-4-yl]-2-[(2-phenylacetyl)amino]ethanimidate |
| SMILES | C/C=C\C(=C/C(=C/CC)C(F)(F)F)C(/N=C(/CNC(=O)Cc1ccccc1)OC)=C(C)CC |
| InChI | InChI=1S/C26H33F3N2O2/c1-6-12-21(17-22(13-7-2)26(27,28)29)25(19(4)8-3)31-24(33-5)18-30-23(32)16-20-14-10-9-11-15-20/h6,9-15,17H,7-8,16,18H2,1-5H3,(H,30,32)/b12-6-,21-17+,22-13-,25-19?,31-24- |
| InChIKey | ASFUTFHXLUNPFF-LRHSRCBESA-N |
| XLogP | 6.48 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|