C29H36FO4P — CID 156844318
3-[2-(2,2-dimethylpropyl)-4-[[3-[2-[ethoxy(methyl)phosphoryl]ethyl]phenoxy]methyl]phenyl]-4-fluorophenol (PubChem CID 156844318) has the molecular formula C29H36FO4P and a molecular weight of 498.58 g/mol. Its IUPAC name is 3-[2-(2,2-dimethylpropyl)-4-[[3-[2-[ethoxy(methyl)phosphoryl]ethyl]phenoxy]methyl]phenyl]-4-fluorophenol.
| Compound Name | 3-[2-(2,2-dimethylpropyl)-4-[[3-[2-[ethoxy(methyl)phosphoryl]ethyl]phenoxy]methyl]phenyl]-4-fluorophenol |
|---|---|
| PubChem CID | 156844318 |
| Molecular Formula | C29H36FO4P |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 3-[2-(2,2-dimethylpropyl)-4-[[3-[2-[ethoxy(methyl)phosphoryl]ethyl]phenoxy]methyl]phenyl]-4-fluorophenol |
| SMILES | CCOP(C)(=O)CCc1cccc(OCc2ccc(-c3cc(O)ccc3F)c(CC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C29H36FO4P/c1-6-34-35(5,32)15-14-21-8-7-9-25(17-21)33-20-22-10-12-26(23(16-22)19-29(2,3)4)27-18-24(31)11-13-28(27)30/h7-13,16-18,31H,6,14-15,19-20H2,1-5H3 |
| InChIKey | KIVUKIVMBGMLRP-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|