About cycloheptane;N,N-dimethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine
cycloheptane;N,N-dimethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine (PubChem CID 156844573) has the molecular formula C24H30N4O
and a molecular weight of 390.53 g/mol. Its IUPAC name is cycloheptane;N,N-dimethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine.
Molecular Properties
| Compound Name | cycloheptane;N,N-dimethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine |
| PubChem CID | 156844573 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | cycloheptane;N,N-dimethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine |
| SMILES | C1CCCCCC1.CN(C)c1ccc2c(n1)OCc1cc(-n3cccn3)ccc1-2 |
| InChI | InChI=1S/C17H16N4O.C7H14/c1-20(2)16-7-6-15-14-5-4-13(21-9-3-8-18-21)10-12(14)11-22-17(15)19-16;1-2-4-6-7-5-3-1/h3-10H,11H2,1-2H3;1-7H2 |
| InChIKey | KGRCOMYXHFJUHD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cycloheptane;N,N-dimethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptane;N,N-dimethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine?
The IUPAC name of cycloheptane;N,N-dimethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine (CID 156844573) is cycloheptane;N,N-dimethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine.
What is the SMILES notation for cycloheptane;N,N-dimethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine?
The canonical SMILES for cycloheptane;N,N-dimethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine is C1CCCCCC1.CN(C)c1ccc2c(n1)OCc1cc(-n3cccn3)ccc1-2.
What is the InChIKey of cycloheptane;N,N-dimethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine?
The InChIKey is KGRCOMYXHFJUHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O.C7H14/c1-20(2)16-7-6-15-14-5-4-13(21-9-3-8-18-21)10-12(14)11-22-17(15)19-16;1-2-4-6-7-5-3-1/h3-10H,11H2,1-2H3;1-7H2.
What are the key properties of cycloheptane;N,N-dimethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine?
cycloheptane;N,N-dimethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine has a molecular weight of 390.53 g/mol, XLogP of 5.62, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptane;N,N-dimethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine is sourced from PubChem (CID 156844573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).