About cyclohexane;N-ethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine
cyclohexane;N-ethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine (PubChem CID 156844626) has the molecular formula C23H28N4O
and a molecular weight of 376.50 g/mol. Its IUPAC name is cyclohexane;N-ethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine.
Molecular Properties
| Compound Name | cyclohexane;N-ethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine |
| PubChem CID | 156844626 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | cyclohexane;N-ethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine |
| SMILES | C1CCCCC1.CCNc1ccc2c(n1)OCc1cc(-n3cccn3)ccc1-2 |
| InChI | InChI=1S/C17H16N4O.C6H12/c1-2-18-16-7-6-15-14-5-4-13(21-9-3-8-19-21)10-12(14)11-22-17(15)20-16;1-2-4-6-5-3-1/h3-10H,2,11H2,1H3,(H,18,20);1-6H2 |
| InChIKey | WVZKZVIXQSIFIZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexane;N-ethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;N-ethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine?
The IUPAC name of cyclohexane;N-ethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine (CID 156844626) is cyclohexane;N-ethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine.
What is the SMILES notation for cyclohexane;N-ethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine?
The canonical SMILES for cyclohexane;N-ethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine is C1CCCCC1.CCNc1ccc2c(n1)OCc1cc(-n3cccn3)ccc1-2.
What is the InChIKey of cyclohexane;N-ethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine?
The InChIKey is WVZKZVIXQSIFIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O.C6H12/c1-2-18-16-7-6-15-14-5-4-13(21-9-3-8-19-21)10-12(14)11-22-17(15)20-16;1-2-4-6-5-3-1/h3-10H,2,11H2,1H3,(H,18,20);1-6H2.
What are the key properties of cyclohexane;N-ethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine?
cyclohexane;N-ethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine has a molecular weight of 376.50 g/mol, XLogP of 5.60, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;N-ethyl-8-pyrazol-1-yl-6H-isochromeno[3,4-b]pyridin-3-amine is sourced from PubChem (CID 156844626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).