About methyl 2-butyl-1,3-oxazole-4-carboxylate
methyl 2-butyl-1,3-oxazole-4-carboxylate (PubChem CID 15684492) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is methyl 2-butyl-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-butyl-1,3-oxazole-4-carboxylate |
| PubChem CID | 15684492 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | methyl 2-butyl-1,3-oxazole-4-carboxylate |
| SMILES | CCCCc1nc(C(=O)OC)co1 |
| InChI | InChI=1S/C9H13NO3/c1-3-4-5-8-10-7(6-13-8)9(11)12-2/h6H,3-5H2,1-2H3 |
| InChIKey | ASJMVIBNWHBKDR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-butyl-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-butyl-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl 2-butyl-1,3-oxazole-4-carboxylate (CID 15684492) is methyl 2-butyl-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl 2-butyl-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl 2-butyl-1,3-oxazole-4-carboxylate is CCCCc1nc(C(=O)OC)co1.
What is the InChIKey of methyl 2-butyl-1,3-oxazole-4-carboxylate?
The InChIKey is ASJMVIBNWHBKDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c1-3-4-5-8-10-7(6-13-8)9(11)12-2/h6H,3-5H2,1-2H3.
What are the key properties of methyl 2-butyl-1,3-oxazole-4-carboxylate?
methyl 2-butyl-1,3-oxazole-4-carboxylate has a molecular weight of 183.21 g/mol, XLogP of 1.80, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-butyl-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 15684492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).